C13H16FN3O4 — CID 175310035
(2S)-3-(3-fluoro-4-nitrophenyl)-2-morpholin-4-ylpropanamide (PubChem CID 175310035) has the molecular formula C13H16FN3O4 and a molecular weight of 297.29 g/mol. Its IUPAC name is (2S)-3-(3-fluoro-4-nitrophenyl)-2-morpholin-4-ylpropanamide.
| Compound Name | (2S)-3-(3-fluoro-4-nitrophenyl)-2-morpholin-4-ylpropanamide |
|---|---|
| PubChem CID | 175310035 |
| Molecular Formula | C13H16FN3O4 |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | (2S)-3-(3-fluoro-4-nitrophenyl)-2-morpholin-4-ylpropanamide |
| SMILES | NC(=O)[C@H](Cc1ccc([N+](=O)[O-])c(F)c1)N1CCOCC1 |
| InChI | InChI=1S/C13H16FN3O4/c14-10-7-9(1-2-11(10)17(19)20)8-12(13(15)18)16-3-5-21-6-4-16/h1-2,7,12H,3-6,8H2,(H2,15,18)/t12-/m0/s1 |
| InChIKey | AGMLFTFVBKUWTR-LBPRGKRZSA-N |
| XLogP | 0.46 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|