About 2-hexylcyclopent-2-en-1-one;pentan-2-one
2-hexylcyclopent-2-en-1-one;pentan-2-one (PubChem CID 175311554) has the molecular formula C16H28O2
and a molecular weight of 252.40 g/mol. Its IUPAC name is 2-hexylcyclopent-2-en-1-one;pentan-2-one.
Molecular Properties
| Compound Name | 2-hexylcyclopent-2-en-1-one;pentan-2-one |
| PubChem CID | 175311554 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 2-hexylcyclopent-2-en-1-one;pentan-2-one |
| SMILES | CCCC(C)=O.CCCCCCC1=CCCC1=O |
| InChI | InChI=1S/C11H18O.C5H10O/c1-2-3-4-5-7-10-8-6-9-11(10)12;1-3-4-5(2)6/h8H,2-7,9H2,1H3;3-4H2,1-2H3 |
| InChIKey | BZSOROFVDFLIRU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hexylcyclopent-2-en-1-one;pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexylcyclopent-2-en-1-one;pentan-2-one?
The IUPAC name of 2-hexylcyclopent-2-en-1-one;pentan-2-one (CID 175311554) is 2-hexylcyclopent-2-en-1-one;pentan-2-one.
What is the SMILES notation for 2-hexylcyclopent-2-en-1-one;pentan-2-one?
The canonical SMILES for 2-hexylcyclopent-2-en-1-one;pentan-2-one is CCCC(C)=O.CCCCCCC1=CCCC1=O.
What is the InChIKey of 2-hexylcyclopent-2-en-1-one;pentan-2-one?
The InChIKey is BZSOROFVDFLIRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O.C5H10O/c1-2-3-4-5-7-10-8-6-9-11(10)12;1-3-4-5(2)6/h8H,2-7,9H2,1H3;3-4H2,1-2H3.
What are the key properties of 2-hexylcyclopent-2-en-1-one;pentan-2-one?
2-hexylcyclopent-2-en-1-one;pentan-2-one has a molecular weight of 252.40 g/mol, XLogP of 4.62, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexylcyclopent-2-en-1-one;pentan-2-one is sourced from PubChem (CID 175311554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).