C30H60I2O4 — CID 175312595
6,6-dibutoxy-1,12-diiodo-7,7-dipentoxydodecane (PubChem CID 175312595) has the molecular formula C30H60I2O4 and a molecular weight of 738.61 g/mol. Its IUPAC name is 6,6-dibutoxy-1,12-diiodo-7,7-dipentoxydodecane.
| Compound Name | 6,6-dibutoxy-1,12-diiodo-7,7-dipentoxydodecane |
|---|---|
| PubChem CID | 175312595 |
| Molecular Formula | C30H60I2O4 |
| Molecular Weight | 738.61 g/mol |
| Exact Mass | 738.26 |
| IUPAC Name | 6,6-dibutoxy-1,12-diiodo-7,7-dipentoxydodecane |
| SMILES | CCCCCOC(CCCCCI)(OCCCCC)C(CCCCCI)(OCCCC)OCCCC |
| InChI | InChI=1S/C30H60I2O4/c1-5-9-19-27-35-30(22-16-14-18-24-32,36-28-20-10-6-2)29(33-25-11-7-3,34-26-12-8-4)21-15-13-17-23-31/h5-28H2,1-4H3 |
| InChIKey | VMLHICVGJMJIJD-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.61 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|