C11H11N3O4 — CID 175313595
4,6-dimethoxy-2-(1,3,5-triazin-2-yl)benzene-1,3-diol (PubChem CID 175313595) has the molecular formula C11H11N3O4 and a molecular weight of 249.23 g/mol. Its IUPAC name is 4,6-dimethoxy-2-(1,3,5-triazin-2-yl)benzene-1,3-diol.
| Compound Name | 4,6-dimethoxy-2-(1,3,5-triazin-2-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 175313595 |
| Molecular Formula | C11H11N3O4 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 4,6-dimethoxy-2-(1,3,5-triazin-2-yl)benzene-1,3-diol |
| SMILES | COc1cc(OC)c(O)c(-c2ncncn2)c1O |
| InChI | InChI=1S/C11H11N3O4/c1-17-6-3-7(18-2)10(16)8(9(6)15)11-13-4-12-5-14-11/h3-5,15-16H,1-2H3 |
| InChIKey | DRFJXPSCJDIQNA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 97.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |