C33H41N3O4 — CID 175315663
3-[3-(hydroxymethyl)-4-methylphenyl]-3-[4-methyl-1-(6-phenylmethoxyhexyl)benzotriazol-5-yl]pentanoic acid (PubChem CID 175315663) has the molecular formula C33H41N3O4 and a molecular weight of 543.71 g/mol. Its IUPAC name is 3-[3-(hydroxymethyl)-4-methylphenyl]-3-[4-methyl-1-(6-phenylmethoxyhexyl)benzotriazol-5-yl]pentanoic acid.
| Compound Name | 3-[3-(hydroxymethyl)-4-methylphenyl]-3-[4-methyl-1-(6-phenylmethoxyhexyl)benzotriazol-5-yl]pentanoic acid |
|---|---|
| PubChem CID | 175315663 |
| Molecular Formula | C33H41N3O4 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.31 |
| IUPAC Name | 3-[3-(hydroxymethyl)-4-methylphenyl]-3-[4-methyl-1-(6-phenylmethoxyhexyl)benzotriazol-5-yl]pentanoic acid |
| SMILES | CCC(CC(=O)O)(c1ccc(C)c(CO)c1)c1ccc2c(nnn2CCCCCCOCc2ccccc2)c1C |
| InChI | InChI=1S/C33H41N3O4/c1-4-33(21-31(38)39,28-15-14-24(2)27(20-28)22-37)29-16-17-30-32(25(29)3)34-35-36(30)18-10-5-6-11-19-40-23-26-12-8-7-9-13-26/h7-9,12-17,20,37H,4-6,10-11,18-19,21-23H2,1-3H3,(H,38,39) |
| InChIKey | GXFUHNGODHIPNC-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|