C22H39NO4 — CID 175318186
2-[[4-(aminomethyl)phenyl]-(8-methylnonoxy)methyl]-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 175318186) has the molecular formula C22H39NO4 and a molecular weight of 381.56 g/mol. Its IUPAC name is 2-[[4-(aminomethyl)phenyl]-(8-methylnonoxy)methyl]-2-(hydroxymethyl)propane-1,3-diol.
| Compound Name | 2-[[4-(aminomethyl)phenyl]-(8-methylnonoxy)methyl]-2-(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 175318186 |
| Molecular Formula | C22H39NO4 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.29 |
| IUPAC Name | 2-[[4-(aminomethyl)phenyl]-(8-methylnonoxy)methyl]-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | CC(C)CCCCCCCOC(c1ccc(CN)cc1)C(CO)(CO)CO |
| InChI | InChI=1S/C22H39NO4/c1-18(2)8-6-4-3-5-7-13-27-21(22(15-24,16-25)17-26)20-11-9-19(14-23)10-12-20/h9-12,18,21,24-26H,3-8,13-17,23H2,1-2H3 |
| InChIKey | JMAHIRGWQZPVHG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|