C12H8F3N9O2 — CID 175318332
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[6-(trifluoromethyl)-3-pyridinyl]methylideneamino]triazole-4-carboxamide (PubChem CID 175318332) has the molecular formula C12H8F3N9O2 and a molecular weight of 367.25 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[6-(trifluoromethyl)-3-pyridinyl]methylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[6-(trifluoromethyl)-3-pyridinyl]methylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 175318332 |
| Molecular Formula | C12H8F3N9O2 |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[6-(trifluoromethyl)-3-pyridinyl]methylideneamino]triazole-4-carboxamide |
| SMILES | Nc1nonc1-n1cc(C(=O)NN=Cc2ccc(C(F)(F)F)nc2)nn1 |
| InChI | InChI=1S/C12H8F3N9O2/c13-12(14,15)8-2-1-6(3-17-8)4-18-20-11(25)7-5-24(23-19-7)10-9(16)21-26-22-10/h1-5H,(H2,16,21)(H,20,25) |
| InChIKey | JYQRAKNELBFZHX-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 150.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|