C12H9BrN8O2 — CID 175602530
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(4-bromophenyl)methylideneamino]triazole-4-carboxamide (PubChem CID 175602530) has the molecular formula C12H9BrN8O2 and a molecular weight of 377.16 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(4-bromophenyl)methylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(4-bromophenyl)methylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 175602530 |
| Molecular Formula | C12H9BrN8O2 |
| Molecular Weight | 377.16 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(4-bromophenyl)methylideneamino]triazole-4-carboxamide |
| SMILES | Nc1nonc1-n1cc(C(=O)NN=Cc2ccc(Br)cc2)nn1 |
| InChI | InChI=1S/C12H9BrN8O2/c13-8-3-1-7(2-4-8)5-15-17-12(22)9-6-21(20-16-9)11-10(14)18-23-19-11/h1-6H,(H2,14,18)(H,17,22) |
| InChIKey | KELKWARCMBWQIO-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 137.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.16 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|