C15H14N2O3 — CID 175318879
(4,7-dimethoxy-1,10-phenanthrolin-2-yl)methanol (PubChem CID 175318879) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is (4,7-dimethoxy-1,10-phenanthrolin-2-yl)methanol.
| Compound Name | (4,7-dimethoxy-1,10-phenanthrolin-2-yl)methanol |
|---|---|
| PubChem CID | 175318879 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | (4,7-dimethoxy-1,10-phenanthrolin-2-yl)methanol |
| SMILES | COc1ccnc2c1ccc1c(OC)cc(CO)nc12 |
| InChI | InChI=1S/C15H14N2O3/c1-19-12-5-6-16-14-10(12)3-4-11-13(20-2)7-9(8-18)17-15(11)14/h3-7,18H,8H2,1-2H3 |
| InChIKey | BRUVXFIOXQHXJM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|