About 5-methoxy-1,7-phenanthroline
5-methoxy-1,7-phenanthroline (PubChem CID 67576947) has the molecular formula C13H10N2O
and a molecular weight of 210.24 g/mol. Its IUPAC name is 5-methoxy-1,7-phenanthroline.
Molecular Properties
| Compound Name | 5-methoxy-1,7-phenanthroline |
| PubChem CID | 67576947 |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 5-methoxy-1,7-phenanthroline |
| SMILES | COc1cc2ncccc2c2ncccc12 |
| InChI | InChI=1S/C13H10N2O/c1-16-12-8-11-9(4-2-6-14-11)13-10(12)5-3-7-15-13/h2-8H,1H3 |
| InChIKey | ZLBSLDOWAZXULR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-1,7-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1,7-phenanthroline?
The IUPAC name of 5-methoxy-1,7-phenanthroline (CID 67576947) is 5-methoxy-1,7-phenanthroline.
What is the SMILES notation for 5-methoxy-1,7-phenanthroline?
The canonical SMILES for 5-methoxy-1,7-phenanthroline is COc1cc2ncccc2c2ncccc12.
What is the InChIKey of 5-methoxy-1,7-phenanthroline?
The InChIKey is ZLBSLDOWAZXULR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O/c1-16-12-8-11-9(4-2-6-14-11)13-10(12)5-3-7-15-13/h2-8H,1H3.
What are the key properties of 5-methoxy-1,7-phenanthroline?
5-methoxy-1,7-phenanthroline has a molecular weight of 210.24 g/mol, XLogP of 2.79, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1,7-phenanthroline is sourced from PubChem (CID 67576947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).