C32H36F2N6O9 — CID 175322317
2,3-dihydroxybutanedioic acid;1-[2-[6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-4-fluoro-1H-indazol-3-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-2-(1,4-oxazepan-4-yl)ethanone (PubChem CID 175322317) has the molecular formula C32H36F2N6O9 and a molecular weight of 686.67 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;1-[2-[6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-4-fluoro-1H-indazol-3-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-2-(1,4-oxazepan-4-yl)ethanone.
| Compound Name | 2,3-dihydroxybutanedioic acid;1-[2-[6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-4-fluoro-1H-indazol-3-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-2-(1,4-oxazepan-4-yl)ethanone |
|---|---|
| PubChem CID | 175322317 |
| Molecular Formula | C32H36F2N6O9 |
| Molecular Weight | 686.67 g/mol |
| Exact Mass | 686.25 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;1-[2-[6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-4-fluoro-1H-indazol-3-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-2-(1,4-oxazepan-4-yl)ethanone |
| SMILES | CCc1cc(O)c(F)cc1-c1cc(F)c2c(-c3nc4c([nH]3)CN(C(=O)CN3CCCOCC3)CC4)n[nH]c2c1.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C28H30F2N6O3.C4H6O6/c1-2-16-12-24(37)19(29)13-18(16)17-10-20(30)26-22(11-17)33-34-27(26)28-31-21-4-6-36(14-23(21)32-28)25(38)15-35-5-3-8-39-9-7-35;5-1(3(7)8)2(6)4(9)10/h10-13,37H,2-9,14-15H2,1H3,(H,31,32)(H,33,34);1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | QZOZFGHVJBBGGU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 225.43 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.67 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |