About N-pyren-1-ylmethanimine
N-pyren-1-ylmethanimine (PubChem CID 175327459) has the molecular formula C17H11N
and a molecular weight of 229.28 g/mol. Its IUPAC name is N-pyren-1-ylmethanimine.
Molecular Properties
| Compound Name | N-pyren-1-ylmethanimine |
| PubChem CID | 175327459 |
| Molecular Formula | C17H11N |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | N-pyren-1-ylmethanimine |
| SMILES | C=Nc1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C17H11N/c1-18-15-10-8-13-6-5-11-3-2-4-12-7-9-14(15)17(13)16(11)12/h2-10H,1H2 |
| InChIKey | MWAJEXAEOVZRDD-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze N-pyren-1-ylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pyren-1-ylmethanimine?
The IUPAC name of N-pyren-1-ylmethanimine (CID 175327459) is N-pyren-1-ylmethanimine.
What is the SMILES notation for N-pyren-1-ylmethanimine?
The canonical SMILES for N-pyren-1-ylmethanimine is C=Nc1ccc2ccc3cccc4ccc1c2c34.
What is the InChIKey of N-pyren-1-ylmethanimine?
The InChIKey is MWAJEXAEOVZRDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11N/c1-18-15-10-8-13-6-5-11-3-2-4-12-7-9-14(15)17(13)16(11)12/h2-10H,1H2.
What are the key properties of N-pyren-1-ylmethanimine?
N-pyren-1-ylmethanimine has a molecular weight of 229.28 g/mol, XLogP of 4.92, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-pyren-1-ylmethanimine is sourced from PubChem (CID 175327459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).