C25H18NPt- — CID 175327463
9H-carbazole;1,9-dihydrofluoren-1-ide;platinum (PubChem CID 175327463) has the molecular formula C25H18NPt- and a molecular weight of 527.50 g/mol. Its IUPAC name is 9H-carbazole;1,9-dihydrofluoren-1-ide;platinum.
| Compound Name | 9H-carbazole;1,9-dihydrofluoren-1-ide;platinum |
|---|---|
| PubChem CID | 175327463 |
| Molecular Formula | C25H18NPt- |
| Molecular Weight | 527.50 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | 9H-carbazole;1,9-dihydrofluoren-1-ide;platinum |
| SMILES | [Pt].[c-]1cccc2c1Cc1ccccc1-2.c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C13H9.C12H9N.Pt/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;/h1-5,7-8H,9H2;1-8,13H;/q-1;; |
| InChIKey | PSZLDHXWNCAZAP-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.50 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|