C28H44INO5 — CID 175328037
[2-[1-(4,5-dihydroxy-2-iodophenyl)ethylamino]-2-oxoethyl] (Z)-octadec-9-enoate (PubChem CID 175328037) has the molecular formula C28H44INO5 and a molecular weight of 601.57 g/mol. Its IUPAC name is [2-[1-(4,5-dihydroxy-2-iodophenyl)ethylamino]-2-oxoethyl] (Z)-octadec-9-enoate.
| Compound Name | [2-[1-(4,5-dihydroxy-2-iodophenyl)ethylamino]-2-oxoethyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 175328037 |
| Molecular Formula | C28H44INO5 |
| Molecular Weight | 601.57 g/mol |
| Exact Mass | 601.23 |
| IUPAC Name | [2-[1-(4,5-dihydroxy-2-iodophenyl)ethylamino]-2-oxoethyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(=O)NC(C)c1cc(O)c(O)cc1I |
| InChI | InChI=1S/C28H44INO5/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-28(34)35-21-27(33)30-22(2)23-19-25(31)26(32)20-24(23)29/h10-11,19-20,22,31-32H,3-9,12-18,21H2,1-2H3,(H,30,33)/b11-10- |
| InChIKey | HRYQAPIQJLEPDM-KHPPLWFESA-N |
| XLogP | 7.46 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.57 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|