C19H39NO6P+ — CID 175328580
(6-but-2-enoyloxy-1-phosphonooxyhexan-3-yl)-tripropylazanium (PubChem CID 175328580) has the molecular formula C19H39NO6P+ and a molecular weight of 408.50 g/mol. Its IUPAC name is (6-but-2-enoyloxy-1-phosphonooxyhexan-3-yl)-tripropylazanium.
| Compound Name | (6-but-2-enoyloxy-1-phosphonooxyhexan-3-yl)-tripropylazanium |
|---|---|
| PubChem CID | 175328580 |
| Molecular Formula | C19H39NO6P+ |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | (6-but-2-enoyloxy-1-phosphonooxyhexan-3-yl)-tripropylazanium |
| SMILES | CC=CC(=O)OCCCC(CCOP(=O)(O)O)[N+](CCC)(CCC)CCC |
| InChI | InChI=1S/C19H38NO6P/c1-5-10-19(21)25-16-9-11-18(12-17-26-27(22,23)24)20(13-6-2,14-7-3)15-8-4/h5,10,18H,6-9,11-17H2,1-4H3,(H-,22,23,24)/p+1 |
| InChIKey | UHVPHZKJHRFOCR-UHFFFAOYSA-O |
| XLogP | 3.80 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|