About (3R)-3-methyl-2-oxo-1,3-dihydropyrazine-4-carboxylic acid
(3R)-3-methyl-2-oxo-1,3-dihydropyrazine-4-carboxylic acid (PubChem CID 175331279) has the molecular formula C6H8N2O3
and a molecular weight of 156.14 g/mol. Its IUPAC name is (3R)-3-methyl-2-oxo-1,3-dihydropyrazine-4-carboxylic acid.
Analyze (3R)-3-methyl-2-oxo-1,3-dihydropyrazine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-methyl-2-oxo-1,3-dihydropyrazine-4-carboxylic acid?
The IUPAC name of (3R)-3-methyl-2-oxo-1,3-dihydropyrazine-4-carboxylic acid (CID 175331279) is (3R)-3-methyl-2-oxo-1,3-dihydropyrazine-4-carboxylic acid.
What is the SMILES notation for (3R)-3-methyl-2-oxo-1,3-dihydropyrazine-4-carboxylic acid?
The canonical SMILES for (3R)-3-methyl-2-oxo-1,3-dihydropyrazine-4-carboxylic acid is C[C@@H]1C(=O)NC=CN1C(=O)O.
What is the InChIKey of (3R)-3-methyl-2-oxo-1,3-dihydropyrazine-4-carboxylic acid?
The InChIKey is INJLKBBFSIWEKZ-SCSAIBSYSA-N. The full InChI is InChI=1S/C6H8N2O3/c1-4-5(9)7-2-3-8(4)6(10)11/h2-4H,1H3,(H,7,9)(H,10,11)/t4-/m1/s1.
What are the key properties of (3R)-3-methyl-2-oxo-1,3-dihydropyrazine-4-carboxylic acid?
(3R)-3-methyl-2-oxo-1,3-dihydropyrazine-4-carboxylic acid has a molecular weight of 156.14 g/mol, XLogP of -0.04, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-methyl-2-oxo-1,3-dihydropyrazine-4-carboxylic acid is sourced from PubChem (CID 175331279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).