C24H24N2 — CID 175331689
1-(2-aminonaphthalen-1-yl)-3,4,5,6-tetramethylnaphthalen-2-amine (PubChem CID 175331689) has the molecular formula C24H24N2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 1-(2-aminonaphthalen-1-yl)-3,4,5,6-tetramethylnaphthalen-2-amine.
| Compound Name | 1-(2-aminonaphthalen-1-yl)-3,4,5,6-tetramethylnaphthalen-2-amine |
|---|---|
| PubChem CID | 175331689 |
| Molecular Formula | C24H24N2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 1-(2-aminonaphthalen-1-yl)-3,4,5,6-tetramethylnaphthalen-2-amine |
| SMILES | Cc1ccc2c(-c3c(N)ccc4ccccc34)c(N)c(C)c(C)c2c1C |
| InChI | InChI=1S/C24H24N2/c1-13-9-11-19-21(14(13)2)15(3)16(4)24(26)23(19)22-18-8-6-5-7-17(18)10-12-20(22)25/h5-12H,25-26H2,1-4H3 |
| InChIKey | CTFDMJONIMGUCF-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|