About amino phenoxy hydrogen phosphite;dihydrochloride
amino phenoxy hydrogen phosphite;dihydrochloride (PubChem CID 175334218) has the molecular formula C6H10Cl2NO4P
and a molecular weight of 262.03 g/mol. Its IUPAC name is amino phenoxy hydrogen phosphite;dihydrochloride.
Molecular Properties
| Compound Name | amino phenoxy hydrogen phosphite;dihydrochloride |
| PubChem CID | 175334218 |
| Molecular Formula | C6H10Cl2NO4P |
| Molecular Weight | 262.03 g/mol |
| Exact Mass | 260.97 |
| IUPAC Name | amino phenoxy hydrogen phosphite;dihydrochloride |
| SMILES | Cl.Cl.NOP(O)OOc1ccccc1 |
| InChI | InChI=1S/C6H8NO4P.2ClH/c7-10-12(8)11-9-6-4-2-1-3-5-6;;/h1-5,8H,7H2;2*1H |
| InChIKey | IAKCIGLIMQWRIC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.03 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze amino phenoxy hydrogen phosphite;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino phenoxy hydrogen phosphite;dihydrochloride?
The IUPAC name of amino phenoxy hydrogen phosphite;dihydrochloride (CID 175334218) is amino phenoxy hydrogen phosphite;dihydrochloride.
What is the SMILES notation for amino phenoxy hydrogen phosphite;dihydrochloride?
The canonical SMILES for amino phenoxy hydrogen phosphite;dihydrochloride is Cl.Cl.NOP(O)OOc1ccccc1.
What is the InChIKey of amino phenoxy hydrogen phosphite;dihydrochloride?
The InChIKey is IAKCIGLIMQWRIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8NO4P.2ClH/c7-10-12(8)11-9-6-4-2-1-3-5-6;;/h1-5,8H,7H2;2*1H.
What are the key properties of amino phenoxy hydrogen phosphite;dihydrochloride?
amino phenoxy hydrogen phosphite;dihydrochloride has a molecular weight of 262.03 g/mol, XLogP of 1.95, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for amino phenoxy hydrogen phosphite;dihydrochloride is sourced from PubChem (CID 175334218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).