C13H18F2O3 — CID 175334356
3-(2,3-difluoro-6-methoxyphenoxy)-2,3-dimethylbutan-2-ol (PubChem CID 175334356) has the molecular formula C13H18F2O3 and a molecular weight of 260.28 g/mol. Its IUPAC name is 3-(2,3-difluoro-6-methoxyphenoxy)-2,3-dimethylbutan-2-ol.
| Compound Name | 3-(2,3-difluoro-6-methoxyphenoxy)-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 175334356 |
| Molecular Formula | C13H18F2O3 |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 3-(2,3-difluoro-6-methoxyphenoxy)-2,3-dimethylbutan-2-ol |
| SMILES | COc1ccc(F)c(F)c1OC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C13H18F2O3/c1-12(2,16)13(3,4)18-11-9(17-5)7-6-8(14)10(11)15/h6-7,16H,1-5H3 |
| InChIKey | VVWGUNRNDDKTJD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |