About 2-fluoro-1,1-dimethylhydrazine
2-fluoro-1,1-dimethylhydrazine (PubChem CID 175337330) has the molecular formula C2H7FN2
and a molecular weight of 78.09 g/mol. Its IUPAC name is 2-fluoro-1,1-dimethylhydrazine.
Molecular Properties
| Compound Name | 2-fluoro-1,1-dimethylhydrazine |
| PubChem CID | 175337330 |
| Molecular Formula | C2H7FN2 |
| Molecular Weight | 78.09 g/mol |
| Exact Mass | 78.06 |
| IUPAC Name | 2-fluoro-1,1-dimethylhydrazine |
| SMILES | CN(C)NF |
| InChI | InChI=1S/C2H7FN2/c1-5(2)4-3/h4H,1-2H3 |
| InChIKey | QXCKVCPJBACLLL-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 78.09 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-1,1-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-1,1-dimethylhydrazine?
The IUPAC name of 2-fluoro-1,1-dimethylhydrazine (CID 175337330) is 2-fluoro-1,1-dimethylhydrazine.
What is the SMILES notation for 2-fluoro-1,1-dimethylhydrazine?
The canonical SMILES for 2-fluoro-1,1-dimethylhydrazine is CN(C)NF.
What is the InChIKey of 2-fluoro-1,1-dimethylhydrazine?
The InChIKey is QXCKVCPJBACLLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7FN2/c1-5(2)4-3/h4H,1-2H3.
What are the key properties of 2-fluoro-1,1-dimethylhydrazine?
2-fluoro-1,1-dimethylhydrazine has a molecular weight of 78.09 g/mol, XLogP of -0.06, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-1,1-dimethylhydrazine is sourced from PubChem (CID 175337330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).