C14H14N2O3S — CID 175337539
(1,1-dioxo-1,3-thiazolidin-3-yl)-(3-pyrrol-1-ylphenyl)methanone (PubChem CID 175337539) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is (1,1-dioxo-1,3-thiazolidin-3-yl)-(3-pyrrol-1-ylphenyl)methanone.
| Compound Name | (1,1-dioxo-1,3-thiazolidin-3-yl)-(3-pyrrol-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 175337539 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | (1,1-dioxo-1,3-thiazolidin-3-yl)-(3-pyrrol-1-ylphenyl)methanone |
| SMILES | O=C(c1cccc(-n2cccc2)c1)N1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H14N2O3S/c17-14(16-8-9-20(18,19)11-16)12-4-3-5-13(10-12)15-6-1-2-7-15/h1-7,10H,8-9,11H2 |
| InChIKey | UISBYCSQOLMLGR-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |