C27H24FNO3 — CID 175339893
2-[4-(2-butoxyphenyl)-3-methylphenyl]-6-fluoroquinoline-4-carboxylic acid (PubChem CID 175339893) has the molecular formula C27H24FNO3 and a molecular weight of 429.49 g/mol. Its IUPAC name is 2-[4-(2-butoxyphenyl)-3-methylphenyl]-6-fluoroquinoline-4-carboxylic acid.
| Compound Name | 2-[4-(2-butoxyphenyl)-3-methylphenyl]-6-fluoroquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 175339893 |
| Molecular Formula | C27H24FNO3 |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 2-[4-(2-butoxyphenyl)-3-methylphenyl]-6-fluoroquinoline-4-carboxylic acid |
| SMILES | CCCCOc1ccccc1-c1ccc(-c2cc(C(=O)O)c3cc(F)ccc3n2)cc1C |
| InChI | InChI=1S/C27H24FNO3/c1-3-4-13-32-26-8-6-5-7-21(26)20-11-9-18(14-17(20)2)25-16-23(27(30)31)22-15-19(28)10-12-24(22)29-25/h5-12,14-16H,3-4,13H2,1-2H3,(H,30,31) |
| InChIKey | BRARBLZARVGHSE-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|