C26H23F2NO — CID 170148996
2-[4-(4-butoxyphenyl)-3-fluorophenyl]-6-fluoro-4-methylquinoline (PubChem CID 170148996) has the molecular formula C26H23F2NO and a molecular weight of 403.47 g/mol. Its IUPAC name is 2-[4-(4-butoxyphenyl)-3-fluorophenyl]-6-fluoro-4-methylquinoline.
| Compound Name | 2-[4-(4-butoxyphenyl)-3-fluorophenyl]-6-fluoro-4-methylquinoline |
|---|---|
| PubChem CID | 170148996 |
| Molecular Formula | C26H23F2NO |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 2-[4-(4-butoxyphenyl)-3-fluorophenyl]-6-fluoro-4-methylquinoline |
| SMILES | CCCCOc1ccc(-c2ccc(-c3cc(C)c4cc(F)ccc4n3)cc2F)cc1 |
| InChI | InChI=1S/C26H23F2NO/c1-3-4-13-30-21-9-5-18(6-10-21)22-11-7-19(15-24(22)28)26-14-17(2)23-16-20(27)8-12-25(23)29-26/h5-12,14-16H,3-4,13H2,1-2H3 |
| InChIKey | SSLLULWOZFFLMV-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|