About 2-[4-(4-butoxyphenyl)phenyl]-6-fluoro-4H-quinolin-4-ide;cobalt
2-[4-(4-butoxyphenyl)phenyl]-6-fluoro-4H-quinolin-4-ide;cobalt (PubChem CID 153380334) has the molecular formula C25H21CoFNO-
and a molecular weight of 429.38 g/mol. Its IUPAC name is 2-[4-(4-butoxyphenyl)phenyl]-6-fluoro-4H-quinolin-4-ide;cobalt.
Molecular Properties
| Compound Name | 2-[4-(4-butoxyphenyl)phenyl]-6-fluoro-4H-quinolin-4-ide;cobalt |
| PubChem CID | 153380334 |
| Molecular Formula | C25H21CoFNO- |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 2-[4-(4-butoxyphenyl)phenyl]-6-fluoro-4H-quinolin-4-ide;cobalt |
| SMILES | CCCCOc1ccc(-c2ccc(-c3c[c-]c4cc(F)ccc4n3)cc2)cc1.[Co] |
| InChI | InChI=1S/C25H21FNO.Co/c1-2-3-16-28-23-12-8-19(9-13-23)18-4-6-20(7-5-18)24-14-10-21-17-22(26)11-15-25(21)27-24;/h4-9,11-15,17H,2-3,16H2,1H3;/q-1; |
| InChIKey | YABOMBWEQXMDKW-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(4-butoxyphenyl)phenyl]-6-fluoro-4H-quinolin-4-ide;cobalt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-butoxyphenyl)phenyl]-6-fluoro-4H-quinolin-4-ide;cobalt?
The IUPAC name of 2-[4-(4-butoxyphenyl)phenyl]-6-fluoro-4H-quinolin-4-ide;cobalt (CID 153380334) is 2-[4-(4-butoxyphenyl)phenyl]-6-fluoro-4H-quinolin-4-ide;cobalt.
What is the SMILES notation for 2-[4-(4-butoxyphenyl)phenyl]-6-fluoro-4H-quinolin-4-ide;cobalt?
The canonical SMILES for 2-[4-(4-butoxyphenyl)phenyl]-6-fluoro-4H-quinolin-4-ide;cobalt is CCCCOc1ccc(-c2ccc(-c3c[c-]c4cc(F)ccc4n3)cc2)cc1.[Co].
What is the InChIKey of 2-[4-(4-butoxyphenyl)phenyl]-6-fluoro-4H-quinolin-4-ide;cobalt?
The InChIKey is YABOMBWEQXMDKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21FNO.Co/c1-2-3-16-28-23-12-8-19(9-13-23)18-4-6-20(7-5-18)24-14-10-21-17-22(26)11-15-25(21)27-24;/h4-9,11-15,17H,2-3,16H2,1H3;/q-1;.
What are the key properties of 2-[4-(4-butoxyphenyl)phenyl]-6-fluoro-4H-quinolin-4-ide;cobalt?
2-[4-(4-butoxyphenyl)phenyl]-6-fluoro-4H-quinolin-4-ide;cobalt has a molecular weight of 429.38 g/mol, XLogP of 6.68, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-butoxyphenyl)phenyl]-6-fluoro-4H-quinolin-4-ide;cobalt is sourced from PubChem (CID 153380334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).