About methanethioic S-acid;octyl-tri(propan-2-yloxy)silane
methanethioic S-acid;octyl-tri(propan-2-yloxy)silane (PubChem CID 175341627) has the molecular formula C18H40O4SSi
and a molecular weight of 380.67 g/mol. Its IUPAC name is methanethioic S-acid;octyl-tri(propan-2-yloxy)silane.
Molecular Properties
| Compound Name | methanethioic S-acid;octyl-tri(propan-2-yloxy)silane |
| PubChem CID | 175341627 |
| Molecular Formula | C18H40O4SSi |
| Molecular Weight | 380.67 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | methanethioic S-acid;octyl-tri(propan-2-yloxy)silane |
| SMILES | CCCCCCCC[Si](OC(C)C)(OC(C)C)OC(C)C.O=CS |
| InChI | InChI=1S/C17H38O3Si.CH2OS/c1-8-9-10-11-12-13-14-21(18-15(2)3,19-16(4)5)20-17(6)7;2-1-3/h15-17H,8-14H2,1-7H3;1H,(H,2,3) |
| InChIKey | YVIMWSJFQZLTPA-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.67 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methanethioic S-acid;octyl-tri(propan-2-yloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanethioic S-acid;octyl-tri(propan-2-yloxy)silane?
The IUPAC name of methanethioic S-acid;octyl-tri(propan-2-yloxy)silane (CID 175341627) is methanethioic S-acid;octyl-tri(propan-2-yloxy)silane.
What is the SMILES notation for methanethioic S-acid;octyl-tri(propan-2-yloxy)silane?
The canonical SMILES for methanethioic S-acid;octyl-tri(propan-2-yloxy)silane is CCCCCCCC[Si](OC(C)C)(OC(C)C)OC(C)C.O=CS.
What is the InChIKey of methanethioic S-acid;octyl-tri(propan-2-yloxy)silane?
The InChIKey is YVIMWSJFQZLTPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H38O3Si.CH2OS/c1-8-9-10-11-12-13-14-21(18-15(2)3,19-16(4)5)20-17(6)7;2-1-3/h15-17H,8-14H2,1-7H3;1H,(H,2,3).
What are the key properties of methanethioic S-acid;octyl-tri(propan-2-yloxy)silane?
methanethioic S-acid;octyl-tri(propan-2-yloxy)silane has a molecular weight of 380.67 g/mol, XLogP of 5.67, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanethioic S-acid;octyl-tri(propan-2-yloxy)silane is sourced from PubChem (CID 175341627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).