C13H12F3NO2S — CID 175342960
3-(isothiocyanatomethyl)-4-[3-(trifluoromethyl)phenyl]butanoic acid (PubChem CID 175342960) has the molecular formula C13H12F3NO2S and a molecular weight of 303.31 g/mol. Its IUPAC name is 3-(isothiocyanatomethyl)-4-[3-(trifluoromethyl)phenyl]butanoic acid.
| Compound Name | 3-(isothiocyanatomethyl)-4-[3-(trifluoromethyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 175342960 |
| Molecular Formula | C13H12F3NO2S |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 3-(isothiocyanatomethyl)-4-[3-(trifluoromethyl)phenyl]butanoic acid |
| SMILES | O=C(O)CC(CN=C=S)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H12F3NO2S/c14-13(15,16)11-3-1-2-9(5-11)4-10(6-12(18)19)7-17-8-20/h1-3,5,10H,4,6-7H2,(H,18,19) |
| InChIKey | LQXOQPBXERPVOO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|