C8H16N4 — CID 175344494
1,2-bis(aziridin-1-yl)piperazine (PubChem CID 175344494) has the molecular formula C8H16N4 and a molecular weight of 168.24 g/mol. Its IUPAC name is 1,2-bis(aziridin-1-yl)piperazine.
| Compound Name | 1,2-bis(aziridin-1-yl)piperazine |
|---|---|
| PubChem CID | 175344494 |
| Molecular Formula | C8H16N4 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | 1,2-bis(aziridin-1-yl)piperazine |
| SMILES | C1CN(N2CC2)C(N2CC2)CN1 |
| InChI | InChI=1S/C8H16N4/c1-2-12(11-5-6-11)8(7-9-1)10-3-4-10/h8-9H,1-7H2 |
| InChIKey | LLVLRGHNTPIUKB-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 21.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|