C7H15N5O — CID 140873535
2,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 140873535) has the molecular formula C7H15N5O and a molecular weight of 185.23 g/mol. Its IUPAC name is 2,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | 2,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 140873535 |
| Molecular Formula | C7H15N5O |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.13 |
| IUPAC Name | 2,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | NC(=O)N1NCCN2CCNCC21 |
| InChI | InChI=1S/C7H15N5O/c8-7(13)12-6-5-9-1-3-11(6)4-2-10-12/h6,9-10H,1-5H2,(H2,8,13) |
| InChIKey | DOWPONHLQIUJCP-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |