C7H12N4O — CID 123882028
3,5,6,7,8,8a-hexahydroimidazo[1,2-a]pyrazine-2-carboxamide (PubChem CID 123882028) has the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. Its IUPAC name is 3,5,6,7,8,8a-hexahydroimidazo[1,2-a]pyrazine-2-carboxamide.
| Compound Name | 3,5,6,7,8,8a-hexahydroimidazo[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 123882028 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 3,5,6,7,8,8a-hexahydroimidazo[1,2-a]pyrazine-2-carboxamide |
| SMILES | NC(=O)C1=NC2CNCCN2C1 |
| InChI | InChI=1S/C7H12N4O/c8-7(12)5-4-11-2-1-9-3-6(11)10-5/h6,9H,1-4H2,(H2,8,12) |
| InChIKey | FUZSELAKIOIYHU-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |