C26H24FN3O2S — CID 175345296
methyl 4-[4-[(4-cyclopropylnaphthalen-1-yl)amino]-7-fluoroquinazolin-2-yl]sulfanylbutanoate (PubChem CID 175345296) has the molecular formula C26H24FN3O2S and a molecular weight of 461.56 g/mol. Its IUPAC name is methyl 4-[4-[(4-cyclopropylnaphthalen-1-yl)amino]-7-fluoroquinazolin-2-yl]sulfanylbutanoate.
| Compound Name | methyl 4-[4-[(4-cyclopropylnaphthalen-1-yl)amino]-7-fluoroquinazolin-2-yl]sulfanylbutanoate |
|---|---|
| PubChem CID | 175345296 |
| Molecular Formula | C26H24FN3O2S |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | methyl 4-[4-[(4-cyclopropylnaphthalen-1-yl)amino]-7-fluoroquinazolin-2-yl]sulfanylbutanoate |
| SMILES | COC(=O)CCCSc1nc(Nc2ccc(C3CC3)c3ccccc23)c2ccc(F)cc2n1 |
| InChI | InChI=1S/C26H24FN3O2S/c1-32-24(31)7-4-14-33-26-29-23-15-17(27)10-11-21(23)25(30-26)28-22-13-12-18(16-8-9-16)19-5-2-3-6-20(19)22/h2-3,5-6,10-13,15-16H,4,7-9,14H2,1H3,(H,28,29,30) |
| InChIKey | JEGZQRVVVXPSKQ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|