C8H8N4O6 — CID 175346014
2-(3,4-dinitroanilino)-N-hydroxyacetamide (PubChem CID 175346014) has the molecular formula C8H8N4O6 and a molecular weight of 256.17 g/mol. Its IUPAC name is 2-(3,4-dinitroanilino)-N-hydroxyacetamide.
| Compound Name | 2-(3,4-dinitroanilino)-N-hydroxyacetamide |
|---|---|
| PubChem CID | 175346014 |
| Molecular Formula | C8H8N4O6 |
| Molecular Weight | 256.17 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 2-(3,4-dinitroanilino)-N-hydroxyacetamide |
| SMILES | O=C(CNc1ccc([N+](=O)[O-])c([N+](=O)[O-])c1)NO |
| InChI | InChI=1S/C8H8N4O6/c13-8(10-14)4-9-5-1-2-6(11(15)16)7(3-5)12(17)18/h1-3,9,14H,4H2,(H,10,13) |
| InChIKey | DWPLADPIHZCYIO-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 147.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.17 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|