About [diphenoxy(diphenyl)-λ5-phosphanyl] dihydrogen phosphate
[diphenoxy(diphenyl)-λ5-phosphanyl] dihydrogen phosphate (PubChem CID 175348481) has the molecular formula C24H22O6P2
and a molecular weight of 468.38 g/mol. Its IUPAC name is [diphenoxy(diphenyl)-λ5-phosphanyl] dihydrogen phosphate.
Molecular Properties
| Compound Name | [diphenoxy(diphenyl)-λ5-phosphanyl] dihydrogen phosphate |
| PubChem CID | 175348481 |
| Molecular Formula | C24H22O6P2 |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | [diphenoxy(diphenyl)-λ5-phosphanyl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OP(Oc1ccccc1)(Oc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H22O6P2/c25-31(26,27)30-32(23-17-9-3-10-18-23,24-19-11-4-12-20-24,28-21-13-5-1-6-14-21)29-22-15-7-2-8-16-22/h1-20H,(H2,25,26,27) |
| InChIKey | AZJITEIZSHNADT-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [diphenoxy(diphenyl)-λ5-phosphanyl] dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [diphenoxy(diphenyl)-λ5-phosphanyl] dihydrogen phosphate?
The IUPAC name of [diphenoxy(diphenyl)-λ5-phosphanyl] dihydrogen phosphate (CID 175348481) is [diphenoxy(diphenyl)-λ5-phosphanyl] dihydrogen phosphate.
What is the SMILES notation for [diphenoxy(diphenyl)-λ5-phosphanyl] dihydrogen phosphate?
The canonical SMILES for [diphenoxy(diphenyl)-λ5-phosphanyl] dihydrogen phosphate is O=P(O)(O)OP(Oc1ccccc1)(Oc1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of [diphenoxy(diphenyl)-λ5-phosphanyl] dihydrogen phosphate?
The InChIKey is AZJITEIZSHNADT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22O6P2/c25-31(26,27)30-32(23-17-9-3-10-18-23,24-19-11-4-12-20-24,28-21-13-5-1-6-14-21)29-22-15-7-2-8-16-22/h1-20H,(H2,25,26,27).
What are the key properties of [diphenoxy(diphenyl)-λ5-phosphanyl] dihydrogen phosphate?
[diphenoxy(diphenyl)-λ5-phosphanyl] dihydrogen phosphate has a molecular weight of 468.38 g/mol, XLogP of 5.20, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [diphenoxy(diphenyl)-λ5-phosphanyl] dihydrogen phosphate is sourced from PubChem (CID 175348481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).