C22H39NO5 — CID 175349118
bis(2,2-dimethylhexan-3-yl) (2S)-5-oxopyrrolidine-1,2-dicarboxylate (PubChem CID 175349118) has the molecular formula C22H39NO5 and a molecular weight of 397.56 g/mol. Its IUPAC name is bis(2,2-dimethylhexan-3-yl) (2S)-5-oxopyrrolidine-1,2-dicarboxylate.
| Compound Name | bis(2,2-dimethylhexan-3-yl) (2S)-5-oxopyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 175349118 |
| Molecular Formula | C22H39NO5 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | bis(2,2-dimethylhexan-3-yl) (2S)-5-oxopyrrolidine-1,2-dicarboxylate |
| SMILES | CCCC(OC(=O)[C@@H]1CCC(=O)N1C(=O)OC(CCC)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C22H39NO5/c1-9-11-16(21(3,4)5)27-19(25)15-13-14-18(24)23(15)20(26)28-17(12-10-2)22(6,7)8/h15-17H,9-14H2,1-8H3/t15-,16?,17?/m0/s1 |
| InChIKey | JZNHKZNDBIOBDS-GTPINHCMSA-N |
| XLogP | 5.09 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |