C19H28ClNO3 — CID 162810916
[(3R,7E,9E)-10-chloro-2,2-dimethyl-5-methylidenedeca-7,9-dien-3-yl] (2S)-1-methyl-5-oxopyrrolidine-2-carboxylate (PubChem CID 162810916) has the molecular formula C19H28ClNO3 and a molecular weight of 353.89 g/mol. Its IUPAC name is [(3R,7E,9E)-10-chloro-2,2-dimethyl-5-methylidenedeca-7,9-dien-3-yl] (2S)-1-methyl-5-oxopyrrolidine-2-carboxylate.
| Compound Name | [(3R,7E,9E)-10-chloro-2,2-dimethyl-5-methylidenedeca-7,9-dien-3-yl] (2S)-1-methyl-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 162810916 |
| Molecular Formula | C19H28ClNO3 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | [(3R,7E,9E)-10-chloro-2,2-dimethyl-5-methylidenedeca-7,9-dien-3-yl] (2S)-1-methyl-5-oxopyrrolidine-2-carboxylate |
| SMILES | C=C(C/C=C/C=C/Cl)C[C@@H](OC(=O)[C@@H]1CCC(=O)N1C)C(C)(C)C |
| InChI | InChI=1S/C19H28ClNO3/c1-14(9-7-6-8-12-20)13-16(19(2,3)4)24-18(23)15-10-11-17(22)21(15)5/h6-8,12,15-16H,1,9-11,13H2,2-5H3/b7-6+,12-8+/t15-,16+/m0/s1 |
| InChIKey | PBUCOVRNOZGUGN-ZNRSUNCHSA-N |
| XLogP | 4.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|