C21H19ClN2O4S — CID 175349501
[4-[[2-(3-chloro-2-methylanilino)benzoyl]amino]phenyl]methanesulfonic acid (PubChem CID 175349501) has the molecular formula C21H19ClN2O4S and a molecular weight of 430.91 g/mol. Its IUPAC name is [4-[[2-(3-chloro-2-methylanilino)benzoyl]amino]phenyl]methanesulfonic acid.
| Compound Name | [4-[[2-(3-chloro-2-methylanilino)benzoyl]amino]phenyl]methanesulfonic acid |
|---|---|
| PubChem CID | 175349501 |
| Molecular Formula | C21H19ClN2O4S |
| Molecular Weight | 430.91 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | [4-[[2-(3-chloro-2-methylanilino)benzoyl]amino]phenyl]methanesulfonic acid |
| SMILES | Cc1c(Cl)cccc1Nc1ccccc1C(=O)Nc1ccc(CS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C21H19ClN2O4S/c1-14-18(22)6-4-8-19(14)24-20-7-3-2-5-17(20)21(25)23-16-11-9-15(10-12-16)13-29(26,27)28/h2-12,24H,13H2,1H3,(H,23,25)(H,26,27,28) |
| InChIKey | OSHZCKSUCJNBAR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.91 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|