C20H25N3OS2 — CID 175349535
1-[3-(1-benzothiophen-3-yl)-2-(dimethylamino)propyl]-3-(2-thiophen-2-ylethyl)urea (PubChem CID 175349535) has the molecular formula C20H25N3OS2 and a molecular weight of 387.57 g/mol. Its IUPAC name is 1-[3-(1-benzothiophen-3-yl)-2-(dimethylamino)propyl]-3-(2-thiophen-2-ylethyl)urea.
| Compound Name | 1-[3-(1-benzothiophen-3-yl)-2-(dimethylamino)propyl]-3-(2-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 175349535 |
| Molecular Formula | C20H25N3OS2 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 1-[3-(1-benzothiophen-3-yl)-2-(dimethylamino)propyl]-3-(2-thiophen-2-ylethyl)urea |
| SMILES | CN(C)C(CNC(=O)NCCc1cccs1)Cc1csc2ccccc12 |
| InChI | InChI=1S/C20H25N3OS2/c1-23(2)16(12-15-14-26-19-8-4-3-7-18(15)19)13-22-20(24)21-10-9-17-6-5-11-25-17/h3-8,11,14,16H,9-10,12-13H2,1-2H3,(H2,21,22,24) |
| InChIKey | AEGCIAGNIMAPKJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |