C22H26FN3OS — CID 175355629
1-[3-(1-benzothiophen-3-yl)-2-(dimethylamino)propyl]-3-[2-(3-fluorophenyl)ethyl]urea (PubChem CID 175355629) has the molecular formula C22H26FN3OS and a molecular weight of 399.54 g/mol. Its IUPAC name is 1-[3-(1-benzothiophen-3-yl)-2-(dimethylamino)propyl]-3-[2-(3-fluorophenyl)ethyl]urea.
| Compound Name | 1-[3-(1-benzothiophen-3-yl)-2-(dimethylamino)propyl]-3-[2-(3-fluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 175355629 |
| Molecular Formula | C22H26FN3OS |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 1-[3-(1-benzothiophen-3-yl)-2-(dimethylamino)propyl]-3-[2-(3-fluorophenyl)ethyl]urea |
| SMILES | CN(C)C(CNC(=O)NCCc1cccc(F)c1)Cc1csc2ccccc12 |
| InChI | InChI=1S/C22H26FN3OS/c1-26(2)19(13-17-15-28-21-9-4-3-8-20(17)21)14-25-22(27)24-11-10-16-6-5-7-18(23)12-16/h3-9,12,15,19H,10-11,13-14H2,1-2H3,(H2,24,25,27) |
| InChIKey | IQZKVQYOAHIEQT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |