C4H4Cl2N2O — CID 175353061
3,3-dichloro-2-cyanopropanamide (PubChem CID 175353061) has the molecular formula C4H4Cl2N2O and a molecular weight of 167.00 g/mol. Its IUPAC name is 3,3-dichloro-2-cyanopropanamide.
| Compound Name | 3,3-dichloro-2-cyanopropanamide |
|---|---|
| PubChem CID | 175353061 |
| Molecular Formula | C4H4Cl2N2O |
| Molecular Weight | 167.00 g/mol |
| Exact Mass | 165.97 |
| IUPAC Name | 3,3-dichloro-2-cyanopropanamide |
| SMILES | N#CC(C(N)=O)C(Cl)Cl |
| InChI | InChI=1S/C4H4Cl2N2O/c5-3(6)2(1-7)4(8)9/h2-3H,(H2,8,9) |
| InChIKey | YLULUHJPTXUMPL-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.00 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|