C9H12N4O2 — CID 4230422
2,4-dicyano-3,3-dimethylpentanediamide (PubChem CID 4230422) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is 2,4-dicyano-3,3-dimethylpentanediamide.
| Compound Name | 2,4-dicyano-3,3-dimethylpentanediamide |
|---|---|
| PubChem CID | 4230422 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2,4-dicyano-3,3-dimethylpentanediamide |
| SMILES | CC(C)(C(C#N)C(N)=O)C(C#N)C(N)=O |
| InChI | InChI=1S/C9H12N4O2/c1-9(2,5(3-10)7(12)14)6(4-11)8(13)15/h5-6H,1-2H3,(H2,12,14)(H2,13,15) |
| InChIKey | KALBESCCXVZJEI-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 133.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |