C6H10N2O2 — CID 55284755
(2R,3S)-3-cyano-2-hydroxy-2-methylbutanamide (PubChem CID 55284755) has the molecular formula C6H10N2O2 and a molecular weight of 142.16 g/mol. Its IUPAC name is (2R,3S)-3-cyano-2-hydroxy-2-methylbutanamide.
| Compound Name | (2R,3S)-3-cyano-2-hydroxy-2-methylbutanamide |
|---|---|
| PubChem CID | 55284755 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | (2R,3S)-3-cyano-2-hydroxy-2-methylbutanamide |
| SMILES | C[C@@H](C#N)[C@@](C)(O)C(N)=O |
| InChI | InChI=1S/C6H10N2O2/c1-4(3-7)6(2,10)5(8)9/h4,10H,1-2H3,(H2,8,9)/t4-,6+/m0/s1 |
| InChIKey | GJYUKKDFOLOSGM-UJURSFKZSA-N |
| XLogP | -0.62 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |