About dimethoxysilane;1-ethoxyethylcyclopropane;methanamine
dimethoxysilane;1-ethoxyethylcyclopropane;methanamine (PubChem CID 175354718) has the molecular formula C10H27NO3Si
and a molecular weight of 237.42 g/mol. Its IUPAC name is dimethoxysilane;1-ethoxyethylcyclopropane;methanamine.
Molecular Properties
| Compound Name | dimethoxysilane;1-ethoxyethylcyclopropane;methanamine |
| PubChem CID | 175354718 |
| Molecular Formula | C10H27NO3Si |
| Molecular Weight | 237.42 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | dimethoxysilane;1-ethoxyethylcyclopropane;methanamine |
| SMILES | CCOC(C)C1CC1.CN.CO[SiH2]OC |
| InChI | InChI=1S/C7H14O.C2H8O2Si.CH5N/c1-3-8-6(2)7-4-5-7;1-3-5-4-2;1-2/h6-7H,3-5H2,1-2H3;5H2,1-2H3;2H2,1H3 |
| InChIKey | DQAHQEKOTPYJAN-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.42 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethoxysilane;1-ethoxyethylcyclopropane;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxysilane;1-ethoxyethylcyclopropane;methanamine?
The IUPAC name of dimethoxysilane;1-ethoxyethylcyclopropane;methanamine (CID 175354718) is dimethoxysilane;1-ethoxyethylcyclopropane;methanamine.
What is the SMILES notation for dimethoxysilane;1-ethoxyethylcyclopropane;methanamine?
The canonical SMILES for dimethoxysilane;1-ethoxyethylcyclopropane;methanamine is CCOC(C)C1CC1.CN.CO[SiH2]OC.
What is the InChIKey of dimethoxysilane;1-ethoxyethylcyclopropane;methanamine?
The InChIKey is DQAHQEKOTPYJAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O.C2H8O2Si.CH5N/c1-3-8-6(2)7-4-5-7;1-3-5-4-2;1-2/h6-7H,3-5H2,1-2H3;5H2,1-2H3;2H2,1H3.
What are the key properties of dimethoxysilane;1-ethoxyethylcyclopropane;methanamine?
dimethoxysilane;1-ethoxyethylcyclopropane;methanamine has a molecular weight of 237.42 g/mol, XLogP of 0.67, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxysilane;1-ethoxyethylcyclopropane;methanamine is sourced from PubChem (CID 175354718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).