(Z)-4-(2-hydroxypropanoyloxy)-4-oxobut-2-enoic acid;prop-2-enoic acid

C10H12O8 — CID 175355038

IUPAC(Z)-4-(2-hydroxypropanoyloxy)-4-oxobut-2-enoic acid;prop-2-enoic acid
SMILESC=CC(=O)O.CC(O)C(=O)OC(=O)/C=C\C(=O)O
InChIInChI=1S/C7H8O6.C3H4O2/c1-4(8)7(12)13-6(11)3-2-5(9)10;1-2-3(4)5/h2-4,8H,1H3,(H,9,10);2H,1H2,(H,4,5)/b3-2-;
InChIKeyWTZMQHATZQBQLH-OLGQORCHSA-N
MW260.20 g/mol
LogP-0.67
Rot. Bonds4

About (Z)-4-(2-hydroxypropanoyloxy)-4-oxobut-2-enoic acid;prop-2-enoic acid

(Z)-4-(2-hydroxypropanoyloxy)-4-oxobut-2-enoic acid;prop-2-enoic acid (PubChem CID 175355038) has the molecular formula C10H12O8 and a molecular weight of 260.20 g/mol. Its IUPAC name is (Z)-4-(2-hydroxypropanoyloxy)-4-oxobut-2-enoic acid;prop-2-enoic acid.

Molecular Properties

Compound Name(Z)-4-(2-hydroxypropanoyloxy)-4-oxobut-2-enoic acid;prop-2-enoic acid
PubChem CID175355038
Molecular FormulaC10H12O8
Molecular Weight260.20 g/mol
Exact Mass260.05
IUPAC Name(Z)-4-(2-hydroxypropanoyloxy)-4-oxobut-2-enoic acid;prop-2-enoic acid
SMILESC=CC(=O)O.CC(O)C(=O)OC(=O)/C=C\C(=O)O
InChIInChI=1S/C7H8O6.C3H4O2/c1-4(8)7(12)13-6(11)3-2-5(9)10;1-2-3(4)5/h2-4,8H,1H3,(H,9,10);2H,1H2,(H,4,5)/b3-2-;
InChIKeyWTZMQHATZQBQLH-OLGQORCHSA-N
XLogP-0.67
TPSA138.20 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.20
LogP ≤ 5-0.67
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (Z)-4-(2-hydroxypropanoyloxy)-4-oxobut-2-enoic acid;prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-4-(2-hydroxypropanoyloxy)-4-oxobut-2-enoic acid;prop-2-enoic acid?
The IUPAC name of (Z)-4-(2-hydroxypropanoyloxy)-4-oxobut-2-enoic acid;prop-2-enoic acid (CID 175355038) is (Z)-4-(2-hydroxypropanoyloxy)-4-oxobut-2-enoic acid;prop-2-enoic acid.
What is the SMILES notation for (Z)-4-(2-hydroxypropanoyloxy)-4-oxobut-2-enoic acid;prop-2-enoic acid?
The canonical SMILES for (Z)-4-(2-hydroxypropanoyloxy)-4-oxobut-2-enoic acid;prop-2-enoic acid is C=CC(=O)O.CC(O)C(=O)OC(=O)/C=C\C(=O)O.
What is the InChIKey of (Z)-4-(2-hydroxypropanoyloxy)-4-oxobut-2-enoic acid;prop-2-enoic acid?
The InChIKey is WTZMQHATZQBQLH-OLGQORCHSA-N. The full InChI is InChI=1S/C7H8O6.C3H4O2/c1-4(8)7(12)13-6(11)3-2-5(9)10;1-2-3(4)5/h2-4,8H,1H3,(H,9,10);2H,1H2,(H,4,5)/b3-2-;.
What are the key properties of (Z)-4-(2-hydroxypropanoyloxy)-4-oxobut-2-enoic acid;prop-2-enoic acid?
(Z)-4-(2-hydroxypropanoyloxy)-4-oxobut-2-enoic acid;prop-2-enoic acid has a molecular weight of 260.20 g/mol, XLogP of -0.67, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-(2-hydroxypropanoyloxy)-4-oxobut-2-enoic acid;prop-2-enoic acid is sourced from PubChem (CID 175355038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).