C10H12O8 — CID 175355038
(Z)-4-(2-hydroxypropanoyloxy)-4-oxobut-2-enoic acid;prop-2-enoic acid (PubChem CID 175355038) has the molecular formula C10H12O8 and a molecular weight of 260.20 g/mol. Its IUPAC name is (Z)-4-(2-hydroxypropanoyloxy)-4-oxobut-2-enoic acid;prop-2-enoic acid.
| Compound Name | (Z)-4-(2-hydroxypropanoyloxy)-4-oxobut-2-enoic acid;prop-2-enoic acid |
|---|---|
| PubChem CID | 175355038 |
| Molecular Formula | C10H12O8 |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | (Z)-4-(2-hydroxypropanoyloxy)-4-oxobut-2-enoic acid;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CC(O)C(=O)OC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C7H8O6.C3H4O2/c1-4(8)7(12)13-6(11)3-2-5(9)10;1-2-3(4)5/h2-4,8H,1H3,(H,9,10);2H,1H2,(H,4,5)/b3-2-; |
| InChIKey | WTZMQHATZQBQLH-OLGQORCHSA-N |
| XLogP | -0.67 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|