C15H24O12 — CID 175355360
2,3-bis[(3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]prop-2-enoic acid (PubChem CID 175355360) has the molecular formula C15H24O12 and a molecular weight of 396.35 g/mol. Its IUPAC name is 2,3-bis[(3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]prop-2-enoic acid.
| Compound Name | 2,3-bis[(3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 175355360 |
| Molecular Formula | C15H24O12 |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 2,3-bis[(3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)C(=CC1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)C1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H24O12/c16-2-6-9(19)11(21)8(18)5(26-6)1-4(15(24)25)14-13(23)12(22)10(20)7(3-17)27-14/h1,5-14,16-23H,2-3H2,(H,24,25)/t5?,6-,7-,8+,9+,10+,11-,12+,13-,14?/m1/s1 |
| InChIKey | SDQBGZUDILUKQG-RRYUZUIPSA-N |
| XLogP | -5.32 |
| TPSA | 217.60 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | -5.32 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|