C17H12Br2O3 — CID 175357791
[4-(2,6-dibromobenzoyl)phenyl] cyclopropanecarboxylate (PubChem CID 175357791) has the molecular formula C17H12Br2O3 and a molecular weight of 424.09 g/mol. Its IUPAC name is [4-(2,6-dibromobenzoyl)phenyl] cyclopropanecarboxylate.
| Compound Name | [4-(2,6-dibromobenzoyl)phenyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 175357791 |
| Molecular Formula | C17H12Br2O3 |
| Molecular Weight | 424.09 g/mol |
| Exact Mass | 421.92 |
| IUPAC Name | [4-(2,6-dibromobenzoyl)phenyl] cyclopropanecarboxylate |
| SMILES | O=C(c1ccc(OC(=O)C2CC2)cc1)c1c(Br)cccc1Br |
| InChI | InChI=1S/C17H12Br2O3/c18-13-2-1-3-14(19)15(13)16(20)10-6-8-12(9-7-10)22-17(21)11-4-5-11/h1-3,6-9,11H,4-5H2 |
| InChIKey | ACGGMFTZDONAKO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.09 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|