About 2-selanylbutanenitrile
2-selanylbutanenitrile (PubChem CID 175358380) has the molecular formula C4H7NSe
and a molecular weight of 148.07 g/mol. Its IUPAC name is 2-selanylbutanenitrile.
Molecular Properties
| Compound Name | 2-selanylbutanenitrile |
| PubChem CID | 175358380 |
| Molecular Formula | C4H7NSe |
| Molecular Weight | 148.07 g/mol |
| Exact Mass | 148.97 |
| IUPAC Name | 2-selanylbutanenitrile |
| SMILES | CCC([SeH])C#N |
| InChI | InChI=1S/C4H7NSe/c1-2-4(6)3-5/h4,6H,2H2,1H3 |
| InChIKey | QXQPTZIPLVKVIJ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.07 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-selanylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-selanylbutanenitrile?
The IUPAC name of 2-selanylbutanenitrile (CID 175358380) is 2-selanylbutanenitrile.
What is the SMILES notation for 2-selanylbutanenitrile?
The canonical SMILES for 2-selanylbutanenitrile is CCC([SeH])C#N.
What is the InChIKey of 2-selanylbutanenitrile?
The InChIKey is QXQPTZIPLVKVIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NSe/c1-2-4(6)3-5/h4,6H,2H2,1H3.
What are the key properties of 2-selanylbutanenitrile?
2-selanylbutanenitrile has a molecular weight of 148.07 g/mol, XLogP of 0.61, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-selanylbutanenitrile is sourced from PubChem (CID 175358380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).