C16H9ClN2O2 — CID 175360180
3-[2-(8-chloroimidazo[1,2-a]pyridin-3-yl)ethynyl]benzoic acid (PubChem CID 175360180) has the molecular formula C16H9ClN2O2 and a molecular weight of 296.71 g/mol. Its IUPAC name is 3-[2-(8-chloroimidazo[1,2-a]pyridin-3-yl)ethynyl]benzoic acid.
| Compound Name | 3-[2-(8-chloroimidazo[1,2-a]pyridin-3-yl)ethynyl]benzoic acid |
|---|---|
| PubChem CID | 175360180 |
| Molecular Formula | C16H9ClN2O2 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 3-[2-(8-chloroimidazo[1,2-a]pyridin-3-yl)ethynyl]benzoic acid |
| SMILES | O=C(O)c1cccc(C#Cc2cnc3c(Cl)cccn23)c1 |
| InChI | InChI=1S/C16H9ClN2O2/c17-14-5-2-8-19-13(10-18-15(14)19)7-6-11-3-1-4-12(9-11)16(20)21/h1-5,8-10H,(H,20,21) |
| InChIKey | FPSFYXSYHGWKMA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|