C20H17ClN2O2 — CID 138556314
butan-2-yl 3-[2-(8-chloroimidazo[1,2-a]pyridin-3-yl)ethynyl]benzoate (PubChem CID 138556314) has the molecular formula C20H17ClN2O2 and a molecular weight of 352.82 g/mol. Its IUPAC name is butan-2-yl 3-[2-(8-chloroimidazo[1,2-a]pyridin-3-yl)ethynyl]benzoate.
| Compound Name | butan-2-yl 3-[2-(8-chloroimidazo[1,2-a]pyridin-3-yl)ethynyl]benzoate |
|---|---|
| PubChem CID | 138556314 |
| Molecular Formula | C20H17ClN2O2 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | butan-2-yl 3-[2-(8-chloroimidazo[1,2-a]pyridin-3-yl)ethynyl]benzoate |
| SMILES | CCC(C)OC(=O)c1cccc(C#Cc2cnc3c(Cl)cccn23)c1 |
| InChI | InChI=1S/C20H17ClN2O2/c1-3-14(2)25-20(24)16-7-4-6-15(12-16)9-10-17-13-22-19-18(21)8-5-11-23(17)19/h4-8,11-14H,3H2,1-2H3 |
| InChIKey | HWMFFPOMXPJHAN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|