C13H10N2O2S — CID 96564318
[(1S)-1-(1,3-thiazol-2-yl)ethyl] 3-cyanobenzoate (PubChem CID 96564318) has the molecular formula C13H10N2O2S and a molecular weight of 258.30 g/mol. Its IUPAC name is [(1S)-1-(1,3-thiazol-2-yl)ethyl] 3-cyanobenzoate.
| Compound Name | [(1S)-1-(1,3-thiazol-2-yl)ethyl] 3-cyanobenzoate |
|---|---|
| PubChem CID | 96564318 |
| Molecular Formula | C13H10N2O2S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | [(1S)-1-(1,3-thiazol-2-yl)ethyl] 3-cyanobenzoate |
| SMILES | C[C@H](OC(=O)c1cccc(C#N)c1)c1nccs1 |
| InChI | InChI=1S/C13H10N2O2S/c1-9(12-15-5-6-18-12)17-13(16)11-4-2-3-10(7-11)8-14/h2-7,9H,1H3/t9-/m0/s1 |
| InChIKey | BHYUBDMDWSHKKO-VIFPVBQESA-N |
| XLogP | 2.93 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |