C18H16N2O2S2 — CID 91646436
1-(1,3-thiazol-2-yl)ethyl 4-(pyridin-3-ylmethylsulfanyl)benzoate (PubChem CID 91646436) has the molecular formula C18H16N2O2S2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-(1,3-thiazol-2-yl)ethyl 4-(pyridin-3-ylmethylsulfanyl)benzoate.
| Compound Name | 1-(1,3-thiazol-2-yl)ethyl 4-(pyridin-3-ylmethylsulfanyl)benzoate |
|---|---|
| PubChem CID | 91646436 |
| Molecular Formula | C18H16N2O2S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 1-(1,3-thiazol-2-yl)ethyl 4-(pyridin-3-ylmethylsulfanyl)benzoate |
| SMILES | CC(OC(=O)c1ccc(SCc2cccnc2)cc1)c1nccs1 |
| InChI | InChI=1S/C18H16N2O2S2/c1-13(17-20-9-10-23-17)22-18(21)15-4-6-16(7-5-15)24-12-14-3-2-8-19-11-14/h2-11,13H,12H2,1H3 |
| InChIKey | SQTDVQXGAPVHRS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |