C21H30N4O — CID 175361850
4-(3,4-dimethylpiperazin-1-yl)-N-(1-phenylethyl)aniline;formamide (PubChem CID 175361850) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is 4-(3,4-dimethylpiperazin-1-yl)-N-(1-phenylethyl)aniline;formamide.
| Compound Name | 4-(3,4-dimethylpiperazin-1-yl)-N-(1-phenylethyl)aniline;formamide |
|---|---|
| PubChem CID | 175361850 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 4-(3,4-dimethylpiperazin-1-yl)-N-(1-phenylethyl)aniline;formamide |
| SMILES | CC(Nc1ccc(N2CCN(C)C(C)C2)cc1)c1ccccc1.NC=O |
| InChI | InChI=1S/C20H27N3.CH3NO/c1-16-15-23(14-13-22(16)3)20-11-9-19(10-12-20)21-17(2)18-7-5-4-6-8-18;2-1-3/h4-12,16-17,21H,13-15H2,1-3H3;1H,(H2,2,3) |
| InChIKey | DXCUOZDIWXNDEY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|